3-bromo-N'-(2-nitrobenzene-1-sulfonyl)benzohydrazide
Chemical Structure Depiction of
3-bromo-N'-(2-nitrobenzene-1-sulfonyl)benzohydrazide
3-bromo-N'-(2-nitrobenzene-1-sulfonyl)benzohydrazide
Compound characteristics
| Compound ID: | 2425-3776 |
| Compound Name: | 3-bromo-N'-(2-nitrobenzene-1-sulfonyl)benzohydrazide |
| Molecular Weight: | 400.2 |
| Molecular Formula: | C13 H10 Br N3 O5 S |
| Smiles: | c1ccc(c(c1)[N+]([O-])=O)S(NNC(c1cccc(c1)[Br])=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.1791 |
| logD: | 2.1753 |
| logSw: | -2.8469 |
| Hydrogen bond acceptors count: | 11 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 99.789 |
| InChI Key: | GDRSUVOPESMDTJ-UHFFFAOYSA-N |