2,4-dichloro-1-(2-nitrophenoxy)benzene
Chemical Structure Depiction of
2,4-dichloro-1-(2-nitrophenoxy)benzene
2,4-dichloro-1-(2-nitrophenoxy)benzene
Compound characteristics
| Compound ID: | 2444-0026 |
| Compound Name: | 2,4-dichloro-1-(2-nitrophenoxy)benzene |
| Molecular Weight: | 284.1 |
| Molecular Formula: | C12 H7 Cl2 N O3 |
| Smiles: | c1ccc(c(c1)[N+]([O-])=O)Oc1ccc(cc1[Cl])[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.3985 |
| logD: | 4.3985 |
| logSw: | -4.6917 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 40.24 |
| InChI Key: | UZUWTTGSBGJFLV-UHFFFAOYSA-N |