N-{1-(4-bromophenyl)-3-[(naphthalen-2-yl)amino]-3-oxoprop-1-en-2-yl}-4-methylbenzamide
Chemical Structure Depiction of
N-{1-(4-bromophenyl)-3-[(naphthalen-2-yl)amino]-3-oxoprop-1-en-2-yl}-4-methylbenzamide
N-{1-(4-bromophenyl)-3-[(naphthalen-2-yl)amino]-3-oxoprop-1-en-2-yl}-4-methylbenzamide
Compound characteristics
| Compound ID: | 2447-2630 |
| Compound Name: | N-{1-(4-bromophenyl)-3-[(naphthalen-2-yl)amino]-3-oxoprop-1-en-2-yl}-4-methylbenzamide |
| Molecular Weight: | 485.38 |
| Molecular Formula: | C27 H21 Br N2 O2 |
| Smiles: | Cc1ccc(cc1)C(NC(=C/c1ccc(cc1)[Br])\C(Nc1ccc2ccccc2c1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 6.7483 |
| logD: | 6.6104 |
| logSw: | -6.7241 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 44.983 |
| InChI Key: | KNRQFTSXGPWEQL-UHFFFAOYSA-N |