N-[2-(3-chloro-4-methoxyphenyl)-2H-benzotriazol-5-yl]benzamide
Chemical Structure Depiction of
N-[2-(3-chloro-4-methoxyphenyl)-2H-benzotriazol-5-yl]benzamide
N-[2-(3-chloro-4-methoxyphenyl)-2H-benzotriazol-5-yl]benzamide
Compound characteristics
| Compound ID: | 2468-3666 |
| Compound Name: | N-[2-(3-chloro-4-methoxyphenyl)-2H-benzotriazol-5-yl]benzamide |
| Molecular Weight: | 378.82 |
| Molecular Formula: | C20 H15 Cl N4 O2 |
| Smiles: | COc1ccc(cc1[Cl])n1nc2ccc(cc2n1)NC(c1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.5348 |
| logD: | 4.52 |
| logSw: | -4.7937 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.994 |
| InChI Key: | HATYUUKXJCQMJH-UHFFFAOYSA-N |