2-oxo-1,2-diphenylethyl 4-bromo-3-nitrobenzoate
Chemical Structure Depiction of
2-oxo-1,2-diphenylethyl 4-bromo-3-nitrobenzoate
2-oxo-1,2-diphenylethyl 4-bromo-3-nitrobenzoate
Compound characteristics
| Compound ID: | 2477-0709 |
| Compound Name: | 2-oxo-1,2-diphenylethyl 4-bromo-3-nitrobenzoate |
| Molecular Weight: | 440.25 |
| Molecular Formula: | C21 H14 Br N O5 |
| Smiles: | c1ccc(cc1)C(C(c1ccccc1)=O)OC(c1ccc(c(c1)[N+]([O-])=O)[Br])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.0751 |
| logD: | 5.0751 |
| logSw: | -5.2339 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 66.92 |
| InChI Key: | OHUZSSSCEGHIIB-HXUWFJFHSA-N |