ethyl 2-{2-[(4-methylbenzene-1-sulfonyl)amino]benzamido}-4-phenyl-1,3-thiazole-5-carboxylate
Chemical Structure Depiction of
ethyl 2-{2-[(4-methylbenzene-1-sulfonyl)amino]benzamido}-4-phenyl-1,3-thiazole-5-carboxylate
ethyl 2-{2-[(4-methylbenzene-1-sulfonyl)amino]benzamido}-4-phenyl-1,3-thiazole-5-carboxylate
Compound characteristics
| Compound ID: | 2513-0512 |
| Compound Name: | ethyl 2-{2-[(4-methylbenzene-1-sulfonyl)amino]benzamido}-4-phenyl-1,3-thiazole-5-carboxylate |
| Molecular Weight: | 521.61 |
| Molecular Formula: | C26 H23 N3 O5 S2 |
| Smiles: | CCOC(c1c(c2ccccc2)nc(NC(c2ccccc2NS(c2ccc(C)cc2)(=O)=O)=O)s1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.5339 |
| logD: | 5.2103 |
| logSw: | -5.4922 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 94.58 |
| InChI Key: | SYMDBBISSFWHOI-UHFFFAOYSA-N |