5-amino-N'-(5-chloro-1-ethyl-2-oxo-1,2-dihydro-3H-indol-3-ylidene)-2-hydroxybenzohydrazide
Chemical Structure Depiction of
5-amino-N'-(5-chloro-1-ethyl-2-oxo-1,2-dihydro-3H-indol-3-ylidene)-2-hydroxybenzohydrazide
5-amino-N'-(5-chloro-1-ethyl-2-oxo-1,2-dihydro-3H-indol-3-ylidene)-2-hydroxybenzohydrazide
Compound characteristics
| Compound ID: | 2530-0169 |
| Compound Name: | 5-amino-N'-(5-chloro-1-ethyl-2-oxo-1,2-dihydro-3H-indol-3-ylidene)-2-hydroxybenzohydrazide |
| Molecular Weight: | 358.78 |
| Molecular Formula: | C17 H15 Cl N4 O3 |
| Smiles: | CCN1C(C(/c2cc(ccc12)[Cl])=N/NC(c1cc(ccc1O)N)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.221 |
| logD: | 2.1946 |
| logSw: | -3.4122 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 4 |
| Polar surface area: | 86.94 |
| InChI Key: | KQLBKJPTDVCYNH-UHFFFAOYSA-N |