3-ethyl-5-{[5-(3-nitrophenyl)furan-2-yl]methylidene}-2-sulfanylidene-1,3-thiazolidin-4-one
Chemical Structure Depiction of
3-ethyl-5-{[5-(3-nitrophenyl)furan-2-yl]methylidene}-2-sulfanylidene-1,3-thiazolidin-4-one
3-ethyl-5-{[5-(3-nitrophenyl)furan-2-yl]methylidene}-2-sulfanylidene-1,3-thiazolidin-4-one
Compound characteristics
| Compound ID: | 2556-1216 |
| Compound Name: | 3-ethyl-5-{[5-(3-nitrophenyl)furan-2-yl]methylidene}-2-sulfanylidene-1,3-thiazolidin-4-one |
| Molecular Weight: | 360.41 |
| Molecular Formula: | C16 H12 N2 O4 S2 |
| Smiles: | CCN1C(/C(=C\c2ccc(c3cccc(c3)[N+]([O-])=O)o2)SC1=S)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2709 |
| logD: | 4.2709 |
| logSw: | -4.4008 |
| Hydrogen bond acceptors count: | 10 |
| Polar surface area: | 57.39 |
| InChI Key: | LVDSKAPXEQZINX-UHFFFAOYSA-N |