ethyl 4-methyl-5-(phenylcarbamoyl)-2-{[2,2,2-trichloro-1-(2-methylpropanamido)ethyl]amino}thiophene-3-carboxylate
Chemical Structure Depiction of
ethyl 4-methyl-5-(phenylcarbamoyl)-2-{[2,2,2-trichloro-1-(2-methylpropanamido)ethyl]amino}thiophene-3-carboxylate
ethyl 4-methyl-5-(phenylcarbamoyl)-2-{[2,2,2-trichloro-1-(2-methylpropanamido)ethyl]amino}thiophene-3-carboxylate
Compound characteristics
| Compound ID: | 2556-1984 |
| Compound Name: | ethyl 4-methyl-5-(phenylcarbamoyl)-2-{[2,2,2-trichloro-1-(2-methylpropanamido)ethyl]amino}thiophene-3-carboxylate |
| Molecular Weight: | 520.86 |
| Molecular Formula: | C21 H24 Cl3 N3 O4 S |
| Smiles: | CCOC(c1c(C)c(C(Nc2ccccc2)=O)sc1NC(C([Cl])([Cl])[Cl])NC(C(C)C)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.6922 |
| logD: | 4.011 |
| logSw: | -4.9109 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 77.36 |
| InChI Key: | XEEOQWHHPVQGRE-FQEVSTJZSA-N |