N-[3-(2-bromo-4-methylanilino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]-2-fluorobenzamide
Chemical Structure Depiction of
N-[3-(2-bromo-4-methylanilino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]-2-fluorobenzamide
N-[3-(2-bromo-4-methylanilino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]-2-fluorobenzamide
Compound characteristics
| Compound ID: | 2681-3482 |
| Compound Name: | N-[3-(2-bromo-4-methylanilino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]-2-fluorobenzamide |
| Molecular Weight: | 498.31 |
| Molecular Formula: | C23 H17 Br F N3 O4 |
| Smiles: | Cc1ccc(c(c1)[Br])NC(/C(=C/c1cccc(c1)[N+]([O-])=O)NC(c1ccccc1F)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.0461 |
| logD: | 3.5108 |
| logSw: | -4.6893 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 77.938 |
| InChI Key: | VKDXGPBOCUTDBV-UHFFFAOYSA-N |