4-chloro-N-(3-chloro-4-oxocyclohexa-2,5-dien-1-ylidene)benzene-1-sulfonamide
Chemical Structure Depiction of
4-chloro-N-(3-chloro-4-oxocyclohexa-2,5-dien-1-ylidene)benzene-1-sulfonamide
4-chloro-N-(3-chloro-4-oxocyclohexa-2,5-dien-1-ylidene)benzene-1-sulfonamide
Compound characteristics
| Compound ID: | 2704-0012 |
| Compound Name: | 4-chloro-N-(3-chloro-4-oxocyclohexa-2,5-dien-1-ylidene)benzene-1-sulfonamide |
| Molecular Weight: | 316.16 |
| Molecular Formula: | C12 H7 Cl2 N O3 S |
| Smiles: | C1=CC(C(=CC/1=N/S(c1ccc(cc1)[Cl])(=O)=O)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 3.2247 |
| logD: | 3.2247 |
| logSw: | -3.5951 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 53.364 |
| InChI Key: | XFOCNDRBIYNOOD-UHFFFAOYSA-N |