2-[(2,5-dichloroanilino)methylidene]-1-benzothiophen-3(2H)-one
Chemical Structure Depiction of
2-[(2,5-dichloroanilino)methylidene]-1-benzothiophen-3(2H)-one
2-[(2,5-dichloroanilino)methylidene]-1-benzothiophen-3(2H)-one
Compound characteristics
| Compound ID: | 2729-0330 |
| Compound Name: | 2-[(2,5-dichloroanilino)methylidene]-1-benzothiophen-3(2H)-one |
| Molecular Weight: | 322.21 |
| Molecular Formula: | C15 H9 Cl2 N O S |
| Smiles: | C(=C1/C(c2ccccc2S1)=O)/Nc1cc(ccc1[Cl])[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.7175 |
| logD: | 4.7175 |
| logSw: | -5.0329 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 24.303 |
| InChI Key: | PUVNFIJTZOLFCN-UHFFFAOYSA-N |