3-chloro-N-(4-chlorophenyl)-N-[(3-oxo-1-benzothiophen-2(3H)-ylidene)methyl]benzamide
Chemical Structure Depiction of
3-chloro-N-(4-chlorophenyl)-N-[(3-oxo-1-benzothiophen-2(3H)-ylidene)methyl]benzamide
3-chloro-N-(4-chlorophenyl)-N-[(3-oxo-1-benzothiophen-2(3H)-ylidene)methyl]benzamide
Compound characteristics
| Compound ID: | 2729-0435 |
| Compound Name: | 3-chloro-N-(4-chlorophenyl)-N-[(3-oxo-1-benzothiophen-2(3H)-ylidene)methyl]benzamide |
| Molecular Weight: | 426.32 |
| Molecular Formula: | C22 H13 Cl2 N O2 S |
| Smiles: | C(=C1/C(c2ccccc2S1)=O)\N(C(c1cccc(c1)[Cl])=O)c1ccc(cc1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 5.4006 |
| logD: | 5.4006 |
| logSw: | -5.9013 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 29.6327 |
| InChI Key: | SCGKBQVRUNOTFJ-UHFFFAOYSA-N |