8,8,10,10-tetramethyl-2-(4-methylphenyl)-8,9,10,11-tetrahydropyrido[4',3':4,5]thieno[3,2-e][1,2,4]triazolo[1,5-c]pyrimidine
Chemical Structure Depiction of
8,8,10,10-tetramethyl-2-(4-methylphenyl)-8,9,10,11-tetrahydropyrido[4',3':4,5]thieno[3,2-e][1,2,4]triazolo[1,5-c]pyrimidine
8,8,10,10-tetramethyl-2-(4-methylphenyl)-8,9,10,11-tetrahydropyrido[4',3':4,5]thieno[3,2-e][1,2,4]triazolo[1,5-c]pyrimidine
Compound characteristics
| Compound ID: | 2730-0643 |
| Compound Name: | 8,8,10,10-tetramethyl-2-(4-methylphenyl)-8,9,10,11-tetrahydropyrido[4',3':4,5]thieno[3,2-e][1,2,4]triazolo[1,5-c]pyrimidine |
| Molecular Weight: | 377.51 |
| Molecular Formula: | C21 H23 N5 S |
| Smiles: | Cc1ccc(cc1)c1nc2c3c4CC(C)(C)NC(C)(C)c4sc3N=Cn2n1 |
| Stereo: | ACHIRAL |
| logP: | 4.6593 |
| logD: | 4.5812 |
| logSw: | -4.5885 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.855 |
| InChI Key: | DXRXPRURXMIZTN-UHFFFAOYSA-N |