2-fluoro-N-[3-(4-methylanilino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide
Chemical Structure Depiction of
2-fluoro-N-[3-(4-methylanilino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide
2-fluoro-N-[3-(4-methylanilino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide
Compound characteristics
| Compound ID: | 2733-3695 |
| Compound Name: | 2-fluoro-N-[3-(4-methylanilino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| Molecular Weight: | 419.41 |
| Molecular Formula: | C23 H18 F N3 O4 |
| Smiles: | Cc1ccc(cc1)NC(/C(=C/c1cccc(c1)[N+]([O-])=O)NC(c1ccccc1F)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.4899 |
| logD: | 3.8061 |
| logSw: | -4.4675 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 78.636 |
| InChI Key: | GTEQATUJVBQCSA-UHFFFAOYSA-N |