N-[3-(4-bromo-3-methylanilino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]thiophene-2-carboxamide
Chemical Structure Depiction of
N-[3-(4-bromo-3-methylanilino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]thiophene-2-carboxamide
N-[3-(4-bromo-3-methylanilino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]thiophene-2-carboxamide
Compound characteristics
| Compound ID: | 2733-3699 |
| Compound Name: | N-[3-(4-bromo-3-methylanilino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]thiophene-2-carboxamide |
| Molecular Weight: | 486.34 |
| Molecular Formula: | C21 H16 Br N3 O4 S |
| Smiles: | Cc1cc(ccc1[Br])NC(/C(=C/c1cccc(c1)[N+]([O-])=O)NC(c1cccs1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.1707 |
| logD: | 5.1436 |
| logSw: | -5.0836 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 79.654 |
| InChI Key: | JZWQGVIFKBRAQM-UHFFFAOYSA-N |