2-[(4-ethoxyphenyl)imino]-N-(4-fluorophenyl)-3-methyl-4-oxo-1,3-thiazinane-6-carboxamide
Chemical Structure Depiction of
2-[(4-ethoxyphenyl)imino]-N-(4-fluorophenyl)-3-methyl-4-oxo-1,3-thiazinane-6-carboxamide
2-[(4-ethoxyphenyl)imino]-N-(4-fluorophenyl)-3-methyl-4-oxo-1,3-thiazinane-6-carboxamide
Compound characteristics
| Compound ID: | 2738-0584 |
| Compound Name: | 2-[(4-ethoxyphenyl)imino]-N-(4-fluorophenyl)-3-methyl-4-oxo-1,3-thiazinane-6-carboxamide |
| Molecular Weight: | 401.46 |
| Molecular Formula: | C20 H20 F N3 O3 S |
| Smiles: | CCOc1ccc(cc1)/N=C1\N(C)C(CC(C(Nc2ccc(cc2)F)=O)S1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.2765 |
| logD: | 3.2745 |
| logSw: | -3.5303 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.299 |
| InChI Key: | NOBKCJMWWDRNIK-KRWDZBQOSA-N |