2-[(3-chloro-4-methylphenyl)imino]-N-(4-fluorophenyl)-3-methyl-4-oxo-1,3-thiazinane-6-carboxamide
Chemical Structure Depiction of
2-[(3-chloro-4-methylphenyl)imino]-N-(4-fluorophenyl)-3-methyl-4-oxo-1,3-thiazinane-6-carboxamide
2-[(3-chloro-4-methylphenyl)imino]-N-(4-fluorophenyl)-3-methyl-4-oxo-1,3-thiazinane-6-carboxamide
Compound characteristics
| Compound ID: | 2738-0598 |
| Compound Name: | 2-[(3-chloro-4-methylphenyl)imino]-N-(4-fluorophenyl)-3-methyl-4-oxo-1,3-thiazinane-6-carboxamide |
| Molecular Weight: | 405.88 |
| Molecular Formula: | C19 H17 Cl F N3 O2 S |
| Smiles: | Cc1ccc(cc1[Cl])/N=C1\N(C)C(CC(C(Nc2ccc(cc2)F)=O)S1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.3423 |
| logD: | 4.3418 |
| logSw: | -4.4505 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.176 |
| InChI Key: | ZPFSKYJGZBSNSR-INIZCTEOSA-N |