2-[(4-chlorophenyl)imino]-N-(2-fluorophenyl)-3-methyl-4-oxo-1,3-thiazinane-6-carboxamide
Chemical Structure Depiction of
2-[(4-chlorophenyl)imino]-N-(2-fluorophenyl)-3-methyl-4-oxo-1,3-thiazinane-6-carboxamide
2-[(4-chlorophenyl)imino]-N-(2-fluorophenyl)-3-methyl-4-oxo-1,3-thiazinane-6-carboxamide
Compound characteristics
| Compound ID: | 2742-2792 |
| Compound Name: | 2-[(4-chlorophenyl)imino]-N-(2-fluorophenyl)-3-methyl-4-oxo-1,3-thiazinane-6-carboxamide |
| Molecular Weight: | 391.85 |
| Molecular Formula: | C18 H15 Cl F N3 O2 S |
| Smiles: | CN1/C(=N/c2ccc(cc2)[Cl])SC(CC1=O)C(Nc1ccccc1F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.5519 |
| logD: | 3.5514 |
| logSw: | -4.0611 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.478 |
| InChI Key: | DNJIFMSWEIFATI-HNNXBMFYSA-N |