N-(2-{[4,6-bis(ethylamino)-1,3,5-triazin-2-yl]oxy}ethyl)-2-(2,4-dichlorophenoxy)acetamide
Chemical Structure Depiction of
N-(2-{[4,6-bis(ethylamino)-1,3,5-triazin-2-yl]oxy}ethyl)-2-(2,4-dichlorophenoxy)acetamide
N-(2-{[4,6-bis(ethylamino)-1,3,5-triazin-2-yl]oxy}ethyl)-2-(2,4-dichlorophenoxy)acetamide
Compound characteristics
| Compound ID: | 2767-0368 |
| Compound Name: | N-(2-{[4,6-bis(ethylamino)-1,3,5-triazin-2-yl]oxy}ethyl)-2-(2,4-dichlorophenoxy)acetamide |
| Molecular Weight: | 429.3 |
| Molecular Formula: | C17 H22 Cl2 N6 O3 |
| Smiles: | CCNc1nc(NCC)nc(n1)OCCNC(COc1ccc(cc1[Cl])[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 3.6728 |
| logD: | 3.6728 |
| logSw: | -3.9325 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 91.483 |
| InChI Key: | VZFGIDPVMRVNPI-UHFFFAOYSA-N |