N-(2-chloro-5-nitrophenyl)-3,4,5-trimethoxybenzamide
Chemical Structure Depiction of
N-(2-chloro-5-nitrophenyl)-3,4,5-trimethoxybenzamide
N-(2-chloro-5-nitrophenyl)-3,4,5-trimethoxybenzamide
Compound characteristics
| Compound ID: | 2783-4927 |
| Compound Name: | N-(2-chloro-5-nitrophenyl)-3,4,5-trimethoxybenzamide |
| Molecular Weight: | 366.76 |
| Molecular Formula: | C16 H15 Cl N2 O6 |
| Smiles: | COc1cc(cc(c1OC)OC)C(Nc1cc(ccc1[Cl])[N+]([O-])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.1961 |
| logD: | 3.1354 |
| logSw: | -3.7634 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 78.991 |
| InChI Key: | XNMQLFYRSAUREF-UHFFFAOYSA-N |