4-chloro-3-nitro-N-(2-phenyl-1,3-benzoxazol-5-yl)benzamide
Chemical Structure Depiction of
4-chloro-3-nitro-N-(2-phenyl-1,3-benzoxazol-5-yl)benzamide
4-chloro-3-nitro-N-(2-phenyl-1,3-benzoxazol-5-yl)benzamide
Compound characteristics
| Compound ID: | 2783-5172 |
| Compound Name: | 4-chloro-3-nitro-N-(2-phenyl-1,3-benzoxazol-5-yl)benzamide |
| Molecular Weight: | 393.78 |
| Molecular Formula: | C20 H12 Cl N3 O4 |
| Smiles: | c1ccc(cc1)c1nc2cc(ccc2o1)NC(c1ccc(c(c1)[N+]([O-])=O)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 4.6566 |
| logD: | 4.5312 |
| logSw: | -5.1277 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 73.22 |
| InChI Key: | BWIXIGSPIZDWID-UHFFFAOYSA-N |