4-(3,5-dibromo-2-hydroxyphenyl)-6-methyl-N-phenyl-2-sulfanylidene-1,2,3,4-tetrahydropyrimidine-5-carboxamide
Chemical Structure Depiction of
4-(3,5-dibromo-2-hydroxyphenyl)-6-methyl-N-phenyl-2-sulfanylidene-1,2,3,4-tetrahydropyrimidine-5-carboxamide
4-(3,5-dibromo-2-hydroxyphenyl)-6-methyl-N-phenyl-2-sulfanylidene-1,2,3,4-tetrahydropyrimidine-5-carboxamide
Compound characteristics
| Compound ID: | 2785-0360 |
| Compound Name: | 4-(3,5-dibromo-2-hydroxyphenyl)-6-methyl-N-phenyl-2-sulfanylidene-1,2,3,4-tetrahydropyrimidine-5-carboxamide |
| Molecular Weight: | 497.21 |
| Molecular Formula: | C18 H15 Br2 N3 O2 S |
| Smiles: | CC1=C(C(c2cc(cc(c2O)[Br])[Br])NC(N1)=S)C(Nc1ccccc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.1848 |
| logD: | 4.1684 |
| logSw: | -4.1966 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 4 |
| Polar surface area: | 61.245 |
| InChI Key: | AEWIIJASSADBES-HNNXBMFYSA-N |