4-(4-chlorophenyl)-N-(2-methoxyphenyl)-6-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxamide
Chemical Structure Depiction of
4-(4-chlorophenyl)-N-(2-methoxyphenyl)-6-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxamide
4-(4-chlorophenyl)-N-(2-methoxyphenyl)-6-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxamide
Compound characteristics
| Compound ID: | 2862-0006 |
| Compound Name: | 4-(4-chlorophenyl)-N-(2-methoxyphenyl)-6-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxamide |
| Molecular Weight: | 371.82 |
| Molecular Formula: | C19 H18 Cl N3 O3 |
| Smiles: | CC1=C(C(c2ccc(cc2)[Cl])NC(N1)=O)C(Nc1ccccc1OC)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.7618 |
| logD: | 2.5453 |
| logSw: | -3.6186 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 65.715 |
| InChI Key: | DFLJPMVPHAQOCN-KRWDZBQOSA-N |