4-butyl-N-[3-(2,5-dichloroanilino)-1-(4-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide
Chemical Structure Depiction of
4-butyl-N-[3-(2,5-dichloroanilino)-1-(4-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide
4-butyl-N-[3-(2,5-dichloroanilino)-1-(4-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide
Compound characteristics
| Compound ID: | 2871-3877 |
| Compound Name: | 4-butyl-N-[3-(2,5-dichloroanilino)-1-(4-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| Molecular Weight: | 481.42 |
| Molecular Formula: | C27 H26 Cl2 N2 O2 |
| Smiles: | CCCCc1ccc(cc1)C(NC(=C/c1ccc(C)cc1)\C(Nc1cc(ccc1[Cl])[Cl])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 7.7236 |
| logD: | 6.8026 |
| logSw: | -6.545 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 44.556 |
| InChI Key: | SMBOXUIYHIVINZ-UHFFFAOYSA-N |