(4-{[1-(4-ethoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl}-2-methoxyphenoxy)acetic acid
Chemical Structure Depiction of
(4-{[1-(4-ethoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl}-2-methoxyphenoxy)acetic acid
(4-{[1-(4-ethoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl}-2-methoxyphenoxy)acetic acid
Compound characteristics
| Compound ID: | 2897-1534 |
| Compound Name: | (4-{[1-(4-ethoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl}-2-methoxyphenoxy)acetic acid |
| Molecular Weight: | 440.41 |
| Molecular Formula: | C22 H20 N2 O8 |
| Smiles: | CCOc1ccc(cc1)N1C(C(=C\c2ccc(c(c2)OC)OCC(O)=O)\C(NC1=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.7732 |
| logD: | -2.4637 |
| logSw: | -2.3349 |
| Hydrogen bond acceptors count: | 12 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 104.114 |
| InChI Key: | ZNGKQLTXXYDTNC-UHFFFAOYSA-N |