ethyl 4-(4-butanoyl-2-fluorophenyl)piperazine-1-carboxylate
Chemical Structure Depiction of
ethyl 4-(4-butanoyl-2-fluorophenyl)piperazine-1-carboxylate
ethyl 4-(4-butanoyl-2-fluorophenyl)piperazine-1-carboxylate
Compound characteristics
| Compound ID: | 2947-0375 |
| Compound Name: | ethyl 4-(4-butanoyl-2-fluorophenyl)piperazine-1-carboxylate |
| Molecular Weight: | 322.38 |
| Molecular Formula: | C17 H23 F N2 O3 |
| Smiles: | CCCC(c1ccc(c(c1)F)N1CCN(CC1)C(=O)OCC)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6823 |
| logD: | 3.6823 |
| logSw: | -4.0521 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 39.417 |
| InChI Key: | ZOPRVVUWGDRNHV-UHFFFAOYSA-N |