2-ethoxyethyl 4-benzamidobenzoate
Chemical Structure Depiction of
2-ethoxyethyl 4-benzamidobenzoate
2-ethoxyethyl 4-benzamidobenzoate
Compound characteristics
| Compound ID: | 3002-0675 |
| Compound Name: | 2-ethoxyethyl 4-benzamidobenzoate |
| Molecular Weight: | 313.35 |
| Molecular Formula: | C18 H19 N O4 |
| Smiles: | CCOCCOC(c1ccc(cc1)NC(c1ccccc1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.2521 |
| logD: | 3.2488 |
| logSw: | -3.3309 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.355 |
| InChI Key: | DEDXZVUDHFZHCL-UHFFFAOYSA-N |