2-(3,4-dimethylanilino)-5-[(5-methylfuran-2-yl)methylidene]-1,3-thiazol-4(5H)-one
Chemical Structure Depiction of
2-(3,4-dimethylanilino)-5-[(5-methylfuran-2-yl)methylidene]-1,3-thiazol-4(5H)-one
2-(3,4-dimethylanilino)-5-[(5-methylfuran-2-yl)methylidene]-1,3-thiazol-4(5H)-one
Compound characteristics
| Compound ID: | 3002-1116 |
| Compound Name: | 2-(3,4-dimethylanilino)-5-[(5-methylfuran-2-yl)methylidene]-1,3-thiazol-4(5H)-one |
| Molecular Weight: | 312.39 |
| Molecular Formula: | C17 H16 N2 O2 S |
| Smiles: | Cc1ccc(cc1C)NC1=NC(/C(=C/c2ccc(C)o2)S1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.5561 |
| logD: | 4.5559 |
| logSw: | -4.3728 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 38.887 |
| InChI Key: | WNTGDVNLAHPEBY-UHFFFAOYSA-N |