ethyl 1-(9H-xanthene-9-carbonyl)piperidine-4-carboxylate
Chemical Structure Depiction of
ethyl 1-(9H-xanthene-9-carbonyl)piperidine-4-carboxylate
ethyl 1-(9H-xanthene-9-carbonyl)piperidine-4-carboxylate
Compound characteristics
| Compound ID: | 3010-2023 |
| Compound Name: | ethyl 1-(9H-xanthene-9-carbonyl)piperidine-4-carboxylate |
| Molecular Weight: | 365.43 |
| Molecular Formula: | C22 H23 N O4 |
| Smiles: | CCOC(C1CCN(CC1)C(C1c2ccccc2Oc2ccccc12)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.3956 |
| logD: | -2.1142 |
| logSw: | -3.6249 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 44.454 |
| InChI Key: | JWBMCZJWOGERKC-UHFFFAOYSA-N |