3,3'-[(4-nitrophenyl)methylene]bis(4-hydroxy-2H-1-benzopyran-2-one)
Chemical Structure Depiction of
3,3'-[(4-nitrophenyl)methylene]bis(4-hydroxy-2H-1-benzopyran-2-one)
3,3'-[(4-nitrophenyl)methylene]bis(4-hydroxy-2H-1-benzopyran-2-one)
Compound characteristics
| Compound ID: | 3029-0552 |
| Compound Name: | 3,3'-[(4-nitrophenyl)methylene]bis(4-hydroxy-2H-1-benzopyran-2-one) |
| Molecular Weight: | 457.4 |
| Molecular Formula: | C25 H15 N O8 |
| Smiles: | c1ccc2c(c1)C(=C(C(C1=C(c3ccccc3OC1=O)O)c1ccc(cc1)[N+]([O-])=O)C(=O)O2)O |
| Stereo: | ACHIRAL |
| logP: | 3.1065 |
| logD: | 0.2508 |
| logSw: | -3.6117 |
| Hydrogen bond acceptors count: | 12 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 105.062 |
| InChI Key: | OGZSNWHXIZDTOX-UHFFFAOYSA-N |