ethyl 2-{4-[(propan-2-yl)oxy]benzamido}-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate
Chemical Structure Depiction of
ethyl 2-{4-[(propan-2-yl)oxy]benzamido}-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate
ethyl 2-{4-[(propan-2-yl)oxy]benzamido}-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate
Compound characteristics
| Compound ID: | 3029-1781 |
| Compound Name: | ethyl 2-{4-[(propan-2-yl)oxy]benzamido}-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| Molecular Weight: | 387.5 |
| Molecular Formula: | C21 H25 N O4 S |
| Smiles: | CCOC(c1c2CCCCc2sc1NC(c1ccc(cc1)OC(C)C)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.8061 |
| logD: | 1.475 |
| logSw: | -4.6268 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.601 |
| InChI Key: | BMCDATFUKZCTHG-UHFFFAOYSA-N |