N-[2-(4-methoxyphenyl)-1,3-benzoxazol-5-yl]-3-[(propan-2-yl)oxy]benzamide
Chemical Structure Depiction of
N-[2-(4-methoxyphenyl)-1,3-benzoxazol-5-yl]-3-[(propan-2-yl)oxy]benzamide
N-[2-(4-methoxyphenyl)-1,3-benzoxazol-5-yl]-3-[(propan-2-yl)oxy]benzamide
Compound characteristics
| Compound ID: | 3029-1945 |
| Compound Name: | N-[2-(4-methoxyphenyl)-1,3-benzoxazol-5-yl]-3-[(propan-2-yl)oxy]benzamide |
| Molecular Weight: | 402.45 |
| Molecular Formula: | C24 H22 N2 O4 |
| Smiles: | CC(C)Oc1cccc(c1)C(Nc1ccc2c(c1)nc(c1ccc(cc1)OC)o2)=O |
| Stereo: | ACHIRAL |
| logP: | 5.2239 |
| logD: | 5.2236 |
| logSw: | -5.0406 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.486 |
| InChI Key: | BLCANGNFQZVGSL-UHFFFAOYSA-N |