methyl 1-benzyl-5-oxopyrrolidine-3-carboxylate
Chemical Structure Depiction of
methyl 1-benzyl-5-oxopyrrolidine-3-carboxylate
methyl 1-benzyl-5-oxopyrrolidine-3-carboxylate
Compound characteristics
| Compound ID: | 3039-0435 |
| Compound Name: | methyl 1-benzyl-5-oxopyrrolidine-3-carboxylate |
| Molecular Weight: | 233.26 |
| Molecular Formula: | C13 H15 N O3 |
| Smiles: | COC(C1CC(N(C1)Cc1ccccc1)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 0.7494 |
| logD: | 0.7494 |
| logSw: | -1.3438 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 38.608 |
| InChI Key: | WTRWSSDZHQOPJI-LLVKDONJSA-N |