3-{5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl}propanoic acid
Chemical Structure Depiction of
3-{5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl}propanoic acid
3-{5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl}propanoic acid
Compound characteristics
| Compound ID: | 3057-0991 |
| Compound Name: | 3-{5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl}propanoic acid |
| Molecular Weight: | 353.41 |
| Molecular Formula: | C15 H15 N O5 S2 |
| Smiles: | CCOc1cc(/C=C2/C(N(CCC(O)=O)C(=S)S2)=O)ccc1O |
| Stereo: | ACHIRAL |
| logP: | 1.3602 |
| logD: | -1.1724 |
| logSw: | -2.1482 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 68.835 |
| InChI Key: | VULAOWDMCOHWSW-UHFFFAOYSA-N |