cyclopentyl 7-(4-chlorophenyl)-4-(3-ethoxy-4-hydroxyphenyl)-2-methyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate
Chemical Structure Depiction of
cyclopentyl 7-(4-chlorophenyl)-4-(3-ethoxy-4-hydroxyphenyl)-2-methyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate
cyclopentyl 7-(4-chlorophenyl)-4-(3-ethoxy-4-hydroxyphenyl)-2-methyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate
Compound characteristics
| Compound ID: | 3064-5117 |
| Compound Name: | cyclopentyl 7-(4-chlorophenyl)-4-(3-ethoxy-4-hydroxyphenyl)-2-methyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate |
| Molecular Weight: | 522.04 |
| Molecular Formula: | C30 H32 Cl N O5 |
| Smiles: | CCOc1cc(ccc1O)C1C(=C(C)NC2CC(CC(C1=2)=O)c1ccc(cc1)[Cl])C(=O)OC1CCCC1 |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 6.1422 |
| logD: | 1.6619 |
| logSw: | -6.0206 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 67.858 |
| InChI Key: | KVVRYFBNEFHCHB-UHFFFAOYSA-N |