2-{[(3-hydroxypropyl)amino]methylidene}-5-phenylcyclohexane-1,3-dione
Chemical Structure Depiction of
2-{[(3-hydroxypropyl)amino]methylidene}-5-phenylcyclohexane-1,3-dione
2-{[(3-hydroxypropyl)amino]methylidene}-5-phenylcyclohexane-1,3-dione
Compound characteristics
| Compound ID: | 3096-0003 |
| Compound Name: | 2-{[(3-hydroxypropyl)amino]methylidene}-5-phenylcyclohexane-1,3-dione |
| Molecular Weight: | 273.33 |
| Molecular Formula: | C16 H19 N O3 |
| Smiles: | C(CNC=C1C(CC(CC1=O)c1ccccc1)=O)CO |
| Stereo: | ACHIRAL |
| logP: | 1.0097 |
| logD: | 1.0086 |
| logSw: | -1.5276 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 56.284 |
| InChI Key: | JWUFXMGGMZSQIM-UHFFFAOYSA-N |