1-(4-bromophenyl)-3-chloro-4-(2-methoxyanilino)-1H-pyrrole-2,5-dione
Chemical Structure Depiction of
1-(4-bromophenyl)-3-chloro-4-(2-methoxyanilino)-1H-pyrrole-2,5-dione
1-(4-bromophenyl)-3-chloro-4-(2-methoxyanilino)-1H-pyrrole-2,5-dione
Compound characteristics
| Compound ID: | 3130-0415 |
| Compound Name: | 1-(4-bromophenyl)-3-chloro-4-(2-methoxyanilino)-1H-pyrrole-2,5-dione |
| Molecular Weight: | 407.65 |
| Molecular Formula: | C17 H12 Br Cl N2 O3 |
| Smiles: | COc1ccccc1NC1=C(C(N(C1=O)c1ccc(cc1)[Br])=O)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 3.829 |
| logD: | 3.7361 |
| logSw: | -4.213 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.195 |
| InChI Key: | FJQIVXKFISWLAB-UHFFFAOYSA-N |