N-[3-(1,3-benzothiazol-2-yl)-4-chlorophenyl]-3-propoxybenzamide
Chemical Structure Depiction of
N-[3-(1,3-benzothiazol-2-yl)-4-chlorophenyl]-3-propoxybenzamide
N-[3-(1,3-benzothiazol-2-yl)-4-chlorophenyl]-3-propoxybenzamide
Compound characteristics
| Compound ID: | 3156-0204 |
| Compound Name: | N-[3-(1,3-benzothiazol-2-yl)-4-chlorophenyl]-3-propoxybenzamide |
| Molecular Weight: | 422.93 |
| Molecular Formula: | C23 H19 Cl N2 O2 S |
| Smiles: | CCCOc1cccc(c1)C(Nc1ccc(c(c1)c1nc2ccccc2s1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 6.8343 |
| logD: | 6.834 |
| logSw: | -6.3505 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.196 |
| InChI Key: | VGGSCAPFRFBFAE-UHFFFAOYSA-N |