dimethyl 1,2,6-trimethyl-4-(4-methyl-3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate
Chemical Structure Depiction of
dimethyl 1,2,6-trimethyl-4-(4-methyl-3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate
dimethyl 1,2,6-trimethyl-4-(4-methyl-3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate
Compound characteristics
| Compound ID: | 3170-5213 |
| Compound Name: | dimethyl 1,2,6-trimethyl-4-(4-methyl-3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| Molecular Weight: | 374.39 |
| Molecular Formula: | C19 H22 N2 O6 |
| Smiles: | CC1=C(C(C(=C(C)N1C)C(=O)OC)c1ccc(C)c(c1)[N+]([O-])=O)C(=O)OC |
| Stereo: | ACHIRAL |
| logP: | 2.8407 |
| logD: | 2.8407 |
| logSw: | -3.2916 |
| Hydrogen bond acceptors count: | 10 |
| Polar surface area: | 77.481 |
| InChI Key: | WKBPEDQFGAOFIG-UHFFFAOYSA-N |