4-chloro-N-[3-(3-chloro-4-methylanilino)quinoxalin-2-yl]benzene-1-sulfonamide
Chemical Structure Depiction of
4-chloro-N-[3-(3-chloro-4-methylanilino)quinoxalin-2-yl]benzene-1-sulfonamide
4-chloro-N-[3-(3-chloro-4-methylanilino)quinoxalin-2-yl]benzene-1-sulfonamide
Compound characteristics
| Compound ID: | 3172-0904 |
| Compound Name: | 4-chloro-N-[3-(3-chloro-4-methylanilino)quinoxalin-2-yl]benzene-1-sulfonamide |
| Molecular Weight: | 459.35 |
| Molecular Formula: | C21 H16 Cl2 N4 O2 S |
| Smiles: | Cc1ccc(cc1[Cl])Nc1c(NS(c2ccc(cc2)[Cl])(=O)=O)nc2ccccc2n1 |
| Stereo: | ACHIRAL |
| logP: | 6.5507 |
| logD: | 5.0054 |
| logSw: | -6.3002 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 68.013 |
| InChI Key: | XUHUQXAABISOAX-UHFFFAOYSA-N |