4-methyl-N-{2-[(5-methylfuran-2-yl)(phenyl)methyl]phenyl}benzene-1-sulfonamide
Chemical Structure Depiction of
4-methyl-N-{2-[(5-methylfuran-2-yl)(phenyl)methyl]phenyl}benzene-1-sulfonamide
4-methyl-N-{2-[(5-methylfuran-2-yl)(phenyl)methyl]phenyl}benzene-1-sulfonamide
Compound characteristics
| Compound ID: | 3178-0091 |
| Compound Name: | 4-methyl-N-{2-[(5-methylfuran-2-yl)(phenyl)methyl]phenyl}benzene-1-sulfonamide |
| Molecular Weight: | 417.53 |
| Molecular Formula: | C25 H23 N O3 S |
| Smiles: | Cc1ccc(cc1)S(Nc1ccccc1C(c1ccccc1)c1ccc(C)o1)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.295 |
| logD: | 6.2933 |
| logSw: | -5.8147 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.739 |
| InChI Key: | SIRMIMUOBOIFAJ-VWLOTQADSA-N |