N-{2-[(4-bromophenyl)(5-methylfuran-2-yl)methyl]phenyl}-4-methylbenzene-1-sulfonamide
Chemical Structure Depiction of
N-{2-[(4-bromophenyl)(5-methylfuran-2-yl)methyl]phenyl}-4-methylbenzene-1-sulfonamide
N-{2-[(4-bromophenyl)(5-methylfuran-2-yl)methyl]phenyl}-4-methylbenzene-1-sulfonamide
Compound characteristics
| Compound ID: | 3178-0096 |
| Compound Name: | N-{2-[(4-bromophenyl)(5-methylfuran-2-yl)methyl]phenyl}-4-methylbenzene-1-sulfonamide |
| Molecular Weight: | 496.42 |
| Molecular Formula: | C25 H22 Br N O3 S |
| Smiles: | Cc1ccc(cc1)S(Nc1ccccc1C(c1ccc(cc1)[Br])c1ccc(C)o1)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 7.1246 |
| logD: | 7.1229 |
| logSw: | -5.9876 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.739 |
| InChI Key: | ZUYGDLJXHCVGAZ-VWLOTQADSA-N |