4-(3-nitrophenyl)-2-phenylquinazoline
Chemical Structure Depiction of
4-(3-nitrophenyl)-2-phenylquinazoline
4-(3-nitrophenyl)-2-phenylquinazoline
Compound characteristics
| Compound ID: | 3181-0212 |
| Compound Name: | 4-(3-nitrophenyl)-2-phenylquinazoline |
| Molecular Weight: | 327.34 |
| Molecular Formula: | C20 H13 N3 O2 |
| Smiles: | c1ccc(cc1)c1nc(c2cccc(c2)[N+]([O-])=O)c2ccccc2n1 |
| Stereo: | ACHIRAL |
| logP: | 5.6021 |
| logD: | 5.6021 |
| logSw: | -6.3865 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 52.133 |
| InChI Key: | WCCIQECOWZLAFO-UHFFFAOYSA-N |