2-[2-(3,4-dimethoxyphenyl)ethenyl]-1-ethylquinolin-1-ium--iodide (1/1)
Chemical Structure Depiction of
2-[2-(3,4-dimethoxyphenyl)ethenyl]-1-ethylquinolin-1-ium--iodide (1/1)
2-[2-(3,4-dimethoxyphenyl)ethenyl]-1-ethylquinolin-1-ium--iodide (1/1)
Compound characteristics
| Compound ID: | 3182-0067 |
| Compound Name: | 2-[2-(3,4-dimethoxyphenyl)ethenyl]-1-ethylquinolin-1-ium--iodide (1/1) |
| Molecular Weight: | 447.31 |
| Molecular Formula: | C21 H22 N O2 |
| Salt: | I- |
| Smiles: | CC[n+]1c(/C=C/c2ccc(c(c2)OC)OC)ccc2ccccc12 |
| Stereo: | ACHIRAL |
| logP: | 4.9059 |
| logD: | 4.9059 |
| logSw: | -5.2045 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 15.1406 |
| InChI Key: | BVKSGJHHIPXEQF-FMIVXFBMSA-N |