5-({4-[2-(4-tert-butylphenoxy)ethoxy]-3-ethoxyphenyl}methylidene)-1-(3-methylphenyl)-1,3-diazinane-2,4,6-trione
Chemical Structure Depiction of
5-({4-[2-(4-tert-butylphenoxy)ethoxy]-3-ethoxyphenyl}methylidene)-1-(3-methylphenyl)-1,3-diazinane-2,4,6-trione
5-({4-[2-(4-tert-butylphenoxy)ethoxy]-3-ethoxyphenyl}methylidene)-1-(3-methylphenyl)-1,3-diazinane-2,4,6-trione
Compound characteristics
| Compound ID: | 3202-0292 |
| Compound Name: | 5-({4-[2-(4-tert-butylphenoxy)ethoxy]-3-ethoxyphenyl}methylidene)-1-(3-methylphenyl)-1,3-diazinane-2,4,6-trione |
| Molecular Weight: | 542.63 |
| Molecular Formula: | C32 H34 N2 O6 |
| Smiles: | CCOc1cc(/C=C2/C(NC(N(C2=O)c2cccc(C)c2)=O)=O)ccc1OCCOc1ccc(cc1)C(C)(C)C |
| Stereo: | ACHIRAL |
| logP: | 5.9542 |
| logD: | 5.8778 |
| logSw: | -5.5178 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 75.252 |
| InChI Key: | SIXRRSZLIKLCDZ-UHFFFAOYSA-N |