5-({5-[(4-chlorophenyl)sulfanyl]furan-2-yl}methylidene)-1,3-diazinane-2,4,6-trione
Chemical Structure Depiction of
5-({5-[(4-chlorophenyl)sulfanyl]furan-2-yl}methylidene)-1,3-diazinane-2,4,6-trione
5-({5-[(4-chlorophenyl)sulfanyl]furan-2-yl}methylidene)-1,3-diazinane-2,4,6-trione
Compound characteristics
| Compound ID: | 3202-0405 |
| Compound Name: | 5-({5-[(4-chlorophenyl)sulfanyl]furan-2-yl}methylidene)-1,3-diazinane-2,4,6-trione |
| Molecular Weight: | 348.76 |
| Molecular Formula: | C15 H9 Cl N2 O4 S |
| Smiles: | C(=C1C(NC(NC1=O)=O)=O)c1ccc(o1)Sc1ccc(cc1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 3.2564 |
| logD: | 2.8985 |
| logSw: | -3.7412 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 70.433 |
| InChI Key: | KXBVYOABAOTVEZ-UHFFFAOYSA-N |