[4-(diphenylmethyl)piperazin-1-yl][rel-(5R,7S)-5-(4-methylphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]methanone
Chemical Structure Depiction of
[4-(diphenylmethyl)piperazin-1-yl][rel-(5R,7S)-5-(4-methylphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]methanone
[4-(diphenylmethyl)piperazin-1-yl][rel-(5R,7S)-5-(4-methylphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]methanone
Compound characteristics
| Compound ID: | 3209-1301 |
| Compound Name: | [4-(diphenylmethyl)piperazin-1-yl][rel-(5R,7S)-5-(4-methylphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]methanone |
| Molecular Weight: | 559.63 |
| Molecular Formula: | C32 H32 F3 N5 O |
| Smiles: | Cc1ccc(cc1)[C@H]1C[C@@H](C(F)(F)F)n2c(c(cn2)C(N2CCN(CC2)C(c2ccccc2)c2ccccc2)=O)N1 |
| Stereo: | RACEMIC MIXTURE (RELATIVE) |
| logP: | 6.2733 |
| logD: | 6.2717 |
| logSw: | -5.471 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.724 |
| InChI Key: | PEAHKDXESGNARZ-VSGBNLITSA-N |