5-[(2,6-dichlorophenyl)methylidene]-3-(1-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-4-one
Chemical Structure Depiction of
5-[(2,6-dichlorophenyl)methylidene]-3-(1-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-4-one
5-[(2,6-dichlorophenyl)methylidene]-3-(1-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-4-one
Compound characteristics
| Compound ID: | 3215-1213 |
| Compound Name: | 5-[(2,6-dichlorophenyl)methylidene]-3-(1-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| Molecular Weight: | 394.34 |
| Molecular Formula: | C18 H13 Cl2 N O S2 |
| Smiles: | [H]C(C)(c1ccccc1)N1C(/C(=C/c2c(cccc2[Cl])[Cl])SC1=S)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.1566 |
| logD: | 5.1566 |
| logSw: | -5.6459 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 15.7832 |
| InChI Key: | ZVHAFTKDKBDINT-NSHDSACASA-N |