5-[(4-fluorophenyl)methylidene]-3-(1-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-4-one
Chemical Structure Depiction of
5-[(4-fluorophenyl)methylidene]-3-(1-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-4-one
5-[(4-fluorophenyl)methylidene]-3-(1-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-4-one
Compound characteristics
| Compound ID: | 3215-1299 |
| Compound Name: | 5-[(4-fluorophenyl)methylidene]-3-(1-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| Molecular Weight: | 343.44 |
| Molecular Formula: | C18 H14 F N O S2 |
| Smiles: | CC(c1ccccc1)N1C(/C(=C\c2ccc(cc2)F)SC1=S)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.6558 |
| logD: | 4.6558 |
| logSw: | -4.4882 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 15.7832 |
| InChI Key: | LKNREEINIRIZAN-LBPRGKRZSA-N |